Vovoka Urolithin B tsara indrindra (1139-83-9) Mpanamboatra sy ozinina

Vovoka urolithin B

Novambra 9, 2020

Urolithin BSpecifications

Name: Urolithin B
Anarana simika: 3-Hydroxy-6H-dibenzo [b, D] pyran-6-ny iray
čas: 1139-83-9
Formula simika: C13H8O3
Meny fitetezana 212.2 g / mol
Color:  White powder
Key InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kaody SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
function: Ny urolithin B dia afaka manatsara ny fiasa mitochondrial sy hozatra.

Ny Urolithin B dia afaka manatsara ny tanjaka hozatra sy ny fiaretana mandritra ny fahanterana.

fampiharana: Urolithin B dia metabolista mikraoba tsinay amin'ny ellagitannis ary mampiseho fampahalemana mahery anti-oxidant sy pro-oxidant miankina amin'ny rafitra sy ny fepetra amin'ny assay. Urolithin B koa dia afaka mampiseho ny estrogen sy / na hetsika anti-estrogen.
Solubility: Solosaina mora foana ao amin'ny N, N-dimethylformamide sy dimethylmethylene. Sulfone, malefaka kely eo amin'ny methanol, ethanol, ary etil acetate
Storage Temp: Hygroscopic, -20 ° C Frizidera, ao anatin'ny atmosfera tsy misy dikany
Fizarana fandefasana: Nalefa tamin'ny haavo ara-pahasalamana ho fanafody tsy simika. Ity vokatra ity dia ampy ho an'ny herinandro vitsivitsy mandritra ny fandefasana tsotra sy ny fotoana laniana amin'ny Customs.

 

Urolithin B Spectrum NMR

Urolithin B (1139-83-9) - NMR Spectrum

 

Raha mila COA, MSDS, HNMR isaky ny vokatra sy fampahalalana hafa ianao dia mifandraisa aminay mpitantana marketing.